C13H12F6O9S — CID 88989706
1,1,1,3,3,3-hexafluoro-2-[2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethoxy]carbonylpropane-2-sulfonic acid (PubChem CID 88989706) has the molecular formula C13H12F6O9S and a molecular weight of 458.29 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethoxy]carbonylpropane-2-sulfonic acid.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethoxy]carbonylpropane-2-sulfonic acid |
|---|---|
| PubChem CID | 88989706 |
| Molecular Formula | C13H12F6O9S |
| Molecular Weight | 458.29 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethoxy]carbonylpropane-2-sulfonic acid |
| SMILES | O=C(COC(=O)C(C(F)(F)F)(C(F)(F)F)S(=O)(=O)O)OC1CCC2CC1OC2=O |
| InChI | InChI=1S/C13H12F6O9S/c14-12(15,16)11(13(17,18)19,29(23,24)25)10(22)26-4-8(20)27-6-2-1-5-3-7(6)28-9(5)21/h5-7H,1-4H2,(H,23,24,25) |
| InChIKey | HLZKEPRZGUTLFA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|