C19H27F3O7S — CID 139427061
3,3,3-trifluoro-2-[2-(1-hydroxy-2-methylprop-2-enoxy)-2-methyladamantane-1-carbonyl]oxypropane-1-sulfonic acid (PubChem CID 139427061) has the molecular formula C19H27F3O7S and a molecular weight of 456.48 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[2-(1-hydroxy-2-methylprop-2-enoxy)-2-methyladamantane-1-carbonyl]oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[2-(1-hydroxy-2-methylprop-2-enoxy)-2-methyladamantane-1-carbonyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 139427061 |
| Molecular Formula | C19H27F3O7S |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 3,3,3-trifluoro-2-[2-(1-hydroxy-2-methylprop-2-enoxy)-2-methyladamantane-1-carbonyl]oxypropane-1-sulfonic acid |
| SMILES | C=C(C)C(O)OC1(C)C2CC3CC(C2)CC1(C(=O)OC(CS(=O)(=O)O)C(F)(F)F)C3 |
| InChI | InChI=1S/C19H27F3O7S/c1-10(2)15(23)29-17(3)13-5-11-4-12(6-13)8-18(17,7-11)16(24)28-14(19(20,21)22)9-30(25,26)27/h11-15,23H,1,4-9H2,2-3H3,(H,25,26,27) |
| InChIKey | GQNAJPYHUZCRKN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|