C18H20O4 — CID 170442880
2-methyl-3-oxo-3-[1-(2-phenylethynyl)cyclohexyl]oxypropanoic acid (PubChem CID 170442880) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-[1-(2-phenylethynyl)cyclohexyl]oxypropanoic acid.
| Compound Name | 2-methyl-3-oxo-3-[1-(2-phenylethynyl)cyclohexyl]oxypropanoic acid |
|---|---|
| PubChem CID | 170442880 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-methyl-3-oxo-3-[1-(2-phenylethynyl)cyclohexyl]oxypropanoic acid |
| SMILES | CC(C(=O)O)C(=O)OC1(C#Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H20O4/c1-14(16(19)20)17(21)22-18(11-6-3-7-12-18)13-10-15-8-4-2-5-9-15/h2,4-5,8-9,14H,3,6-7,11-12H2,1H3,(H,19,20) |
| InChIKey | UUGQKQITEKZFHY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|