C19H22O4 — CID 10859980
1-O-ethyl 3-O-[1-(2-phenylethynyl)cyclohexyl] propanedioate (PubChem CID 10859980) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[1-(2-phenylethynyl)cyclohexyl] propanedioate.
| Compound Name | 1-O-ethyl 3-O-[1-(2-phenylethynyl)cyclohexyl] propanedioate |
|---|---|
| PubChem CID | 10859980 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-O-ethyl 3-O-[1-(2-phenylethynyl)cyclohexyl] propanedioate |
| SMILES | CCOC(=O)CC(=O)OC1(C#Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C19H22O4/c1-2-22-17(20)15-18(21)23-19(12-7-4-8-13-19)14-11-16-9-5-3-6-10-16/h3,5-6,9-10H,2,4,7-8,12-13,15H2,1H3 |
| InChIKey | FPFRJGRCIFDOEK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|