C19H20O2 — CID 134957937
ethyl (3E)-4-(2-phenylethynyl)-3-prop-2-enylhexa-3,5-dienoate (PubChem CID 134957937) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is ethyl (3E)-4-(2-phenylethynyl)-3-prop-2-enylhexa-3,5-dienoate.
| Compound Name | ethyl (3E)-4-(2-phenylethynyl)-3-prop-2-enylhexa-3,5-dienoate |
|---|---|
| PubChem CID | 134957937 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | ethyl (3E)-4-(2-phenylethynyl)-3-prop-2-enylhexa-3,5-dienoate |
| SMILES | C=CC/C(CC(=O)OCC)=C(\C#Cc1ccccc1)C=C |
| InChI | InChI=1S/C19H20O2/c1-4-10-18(15-19(20)21-6-3)17(5-2)14-13-16-11-8-7-9-12-16/h4-5,7-9,11-12H,1-2,6,10,15H2,3H3/b18-17+ |
| InChIKey | MYFFDNSHHKHFIC-ISLYRVAYSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|