C19H23NO4 — CID 102299778
methyl (2S)-1-[(3S)-5-ethoxy-5-oxo-1-phenylpent-1-yn-3-yl]pyrrolidine-2-carboxylate (PubChem CID 102299778) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is methyl (2S)-1-[(3S)-5-ethoxy-5-oxo-1-phenylpent-1-yn-3-yl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(3S)-5-ethoxy-5-oxo-1-phenylpent-1-yn-3-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 102299778 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | methyl (2S)-1-[(3S)-5-ethoxy-5-oxo-1-phenylpent-1-yn-3-yl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C[C@@H](C#Cc1ccccc1)N1CCC[C@H]1C(=O)OC |
| InChI | InChI=1S/C19H23NO4/c1-3-24-18(21)14-16(12-11-15-8-5-4-6-9-15)20-13-7-10-17(20)19(22)23-2/h4-6,8-9,16-17H,3,7,10,13-14H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | QLVREKVGBGNFOV-SJORKVTESA-N |
| XLogP | 2.00 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|