C16H19NO2 — CID 115537498
methyl (3S)-1-(3-phenylprop-2-ynyl)piperidine-3-carboxylate (PubChem CID 115537498) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl (3S)-1-(3-phenylprop-2-ynyl)piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-(3-phenylprop-2-ynyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 115537498 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | methyl (3S)-1-(3-phenylprop-2-ynyl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(CC#Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H19NO2/c1-19-16(18)15-10-6-12-17(13-15)11-5-9-14-7-3-2-4-8-14/h2-4,7-8,15H,6,10-13H2,1H3/t15-/m0/s1 |
| InChIKey | KGVSQQDXGHETAS-HNNXBMFYSA-N |
| XLogP | 1.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|