C24H41N5O5 — CID 20825346
2-propan-2-yloxyethyl N-[N-[1-[(1-cyanocyclopentyl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate (PubChem CID 20825346) has the molecular formula C24H41N5O5 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl N-[N-[1-[(1-cyanocyclopentyl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate.
| Compound Name | 2-propan-2-yloxyethyl N-[N-[1-[(1-cyanocyclopentyl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 20825346 |
| Molecular Formula | C24H41N5O5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | 2-propan-2-yloxyethyl N-[N-[1-[(1-cyanocyclopentyl)amino]-4,4-dimethyl-1-oxopentan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
| SMILES | CC(C)OCCOC(=O)N/C(=N\C(CC(C)(C)C)C(=O)NC1(C#N)CCCC1)N1CCOCC1 |
| InChI | InChI=1S/C24H41N5O5/c1-18(2)33-14-15-34-22(31)27-21(29-10-12-32-13-11-29)26-19(16-23(3,4)5)20(30)28-24(17-25)8-6-7-9-24/h18-19H,6-16H2,1-5H3,(H,28,30)(H,26,27,31) |
| InChIKey | LSJRPMYZHOPPII-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|