C24H38N6O6 — CID 22566353
4-cyano-4-[[3-cyclohexyl-2-[[(ethoxycarbonylamino)-morpholin-4-ylmethylidene]amino]propanoyl]amino]piperidine-1-carboxylic acid (PubChem CID 22566353) has the molecular formula C24H38N6O6 and a molecular weight of 506.60 g/mol. Its IUPAC name is 4-cyano-4-[[3-cyclohexyl-2-[[(ethoxycarbonylamino)-morpholin-4-ylmethylidene]amino]propanoyl]amino]piperidine-1-carboxylic acid.
| Compound Name | 4-cyano-4-[[3-cyclohexyl-2-[[(ethoxycarbonylamino)-morpholin-4-ylmethylidene]amino]propanoyl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 22566353 |
| Molecular Formula | C24H38N6O6 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | 4-cyano-4-[[3-cyclohexyl-2-[[(ethoxycarbonylamino)-morpholin-4-ylmethylidene]amino]propanoyl]amino]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)N/C(=N\C(CC1CCCCC1)C(=O)NC1(C#N)CCN(C(=O)O)CC1)N1CCOCC1 |
| InChI | InChI=1S/C24H38N6O6/c1-2-36-22(32)27-21(29-12-14-35-15-13-29)26-19(16-18-6-4-3-5-7-18)20(31)28-24(17-25)8-10-30(11-9-24)23(33)34/h18-19H,2-16H2,1H3,(H,28,31)(H,33,34)(H,26,27,32) |
| InChIKey | QSAXUNNZCRIXPL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 156.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|