C26H44N6O4 — CID 22091416
ethyl N-[N-[1-[(4-cyano-1-propylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate (PubChem CID 22091416) has the molecular formula C26H44N6O4 and a molecular weight of 504.68 g/mol. Its IUPAC name is ethyl N-[N-[1-[(4-cyano-1-propylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate.
| Compound Name | ethyl N-[N-[1-[(4-cyano-1-propylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
|---|---|
| PubChem CID | 22091416 |
| Molecular Formula | C26H44N6O4 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.34 |
| IUPAC Name | ethyl N-[N-[1-[(4-cyano-1-propylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-morpholin-4-ylcarbonimidoyl]carbamate |
| SMILES | CCCN1CCC(C#N)(NC(=O)C(CC2CCCCC2)/N=C(\NC(=O)OCC)N2CCOCC2)CC1 |
| InChI | InChI=1S/C26H44N6O4/c1-3-12-31-13-10-26(20-27,11-14-31)30-23(33)22(19-21-8-6-5-7-9-21)28-24(29-25(34)36-4-2)32-15-17-35-18-16-32/h21-22H,3-19H2,1-2H3,(H,30,33)(H,28,29,34) |
| InChIKey | SGXQVKCSGUDWHG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|