C23H41N7O3 — CID 91282381
N-(4-cyano-1-propylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide (PubChem CID 91282381) has the molecular formula C23H41N7O3 and a molecular weight of 463.63 g/mol. Its IUPAC name is N-(4-cyano-1-propylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide.
| Compound Name | N-(4-cyano-1-propylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 91282381 |
| Molecular Formula | C23H41N7O3 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | N-(4-cyano-1-propylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-morpholin-4-ylmethylidene]amino]-4-methylpentanamide |
| SMILES | CCCN1CCC(C#N)(NC(=O)C(CC(C)C)/N=C(\NC(=O)NCC)N2CCOCC2)CC1 |
| InChI | InChI=1S/C23H41N7O3/c1-5-9-29-10-7-23(17-24,8-11-29)28-20(31)19(16-18(3)4)26-21(27-22(32)25-6-2)30-12-14-33-15-13-30/h18-19H,5-16H2,1-4H3,(H,28,31)(H2,25,26,27,32) |
| InChIKey | UQPJUBLTFHYOFJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|