C26H40N6O2 — CID 91614637
N-(4-cyano-1-propylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-phenylmethylidene]amino]-4,4-dimethylpentanamide (PubChem CID 91614637) has the molecular formula C26H40N6O2 and a molecular weight of 468.65 g/mol. Its IUPAC name is N-(4-cyano-1-propylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-phenylmethylidene]amino]-4,4-dimethylpentanamide.
| Compound Name | N-(4-cyano-1-propylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-phenylmethylidene]amino]-4,4-dimethylpentanamide |
|---|---|
| PubChem CID | 91614637 |
| Molecular Formula | C26H40N6O2 |
| Molecular Weight | 468.65 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | N-(4-cyano-1-propylpiperidin-4-yl)-2-[[(ethylcarbamoylamino)-phenylmethylidene]amino]-4,4-dimethylpentanamide |
| SMILES | CCCN1CCC(C#N)(NC(=O)C(CC(C)(C)C)/N=C(\NC(=O)NCC)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H40N6O2/c1-6-15-32-16-13-26(19-27,14-17-32)31-23(33)21(18-25(3,4)5)29-22(30-24(34)28-7-2)20-11-9-8-10-12-20/h8-12,21H,6-7,13-18H2,1-5H3,(H,31,33)(H2,28,29,30,34) |
| InChIKey | WMYHKFONHTZTMI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.65 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|