C24H33N5O3 — CID 22674362
[N-[1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-phenylcarbonimidoyl]carbamic acid (PubChem CID 22674362) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is [N-[1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-phenylcarbonimidoyl]carbamic acid.
| Compound Name | [N-[1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-phenylcarbonimidoyl]carbamic acid |
|---|---|
| PubChem CID | 22674362 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | [N-[1-[(4-cyano-1-methylpiperidin-4-yl)amino]-3-cyclohexyl-1-oxopropan-2-yl]-C-phenylcarbonimidoyl]carbamic acid |
| SMILES | CN1CCC(C#N)(NC(=O)C(CC2CCCCC2)/N=C(\NC(=O)O)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N5O3/c1-29-14-12-24(17-25,13-15-29)28-22(30)20(16-18-8-4-2-5-9-18)26-21(27-23(31)32)19-10-6-3-7-11-19/h3,6-7,10-11,18,20H,2,4-5,8-9,12-16H2,1H3,(H,26,27)(H,28,30)(H,31,32) |
| InChIKey | BDFAXEAIGCKDCW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|