C24H30FN5O2 — CID 135507254
N-(4-cyano-1-methylpiperidin-4-yl)-3-cyclohexyl-2-[(6-fluoro-3-oxoisoindol-1-ylidene)amino]propanamide (PubChem CID 135507254) has the molecular formula C24H30FN5O2 and a molecular weight of 439.54 g/mol. Its IUPAC name is N-(4-cyano-1-methylpiperidin-4-yl)-3-cyclohexyl-2-[(6-fluoro-3-oxoisoindol-1-ylidene)amino]propanamide.
| Compound Name | N-(4-cyano-1-methylpiperidin-4-yl)-3-cyclohexyl-2-[(6-fluoro-3-oxoisoindol-1-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 135507254 |
| Molecular Formula | C24H30FN5O2 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | N-(4-cyano-1-methylpiperidin-4-yl)-3-cyclohexyl-2-[(6-fluoro-3-oxoisoindol-1-ylidene)amino]propanamide |
| SMILES | CN1CCC(C#N)(NC(=O)C(CC2CCCCC2)/N=C2\NC(=O)c3ccc(F)cc32)CC1 |
| InChI | InChI=1S/C24H30FN5O2/c1-30-11-9-24(15-26,10-12-30)29-23(32)20(13-16-5-3-2-4-6-16)27-21-19-14-17(25)7-8-18(19)22(31)28-21/h7-8,14,16,20H,2-6,9-13H2,1H3,(H,29,32)(H,27,28,31) |
| InChIKey | UXTHSMZOGDHDKU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|