C26H35N5O2 — CID 135724428
N-(4-cyano-1-propylpiperidin-4-yl)-3-cyclohexyl-2-[(3-oxoisoindol-1-ylidene)amino]propanamide (PubChem CID 135724428) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-(4-cyano-1-propylpiperidin-4-yl)-3-cyclohexyl-2-[(3-oxoisoindol-1-ylidene)amino]propanamide.
| Compound Name | N-(4-cyano-1-propylpiperidin-4-yl)-3-cyclohexyl-2-[(3-oxoisoindol-1-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 135724428 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | N-(4-cyano-1-propylpiperidin-4-yl)-3-cyclohexyl-2-[(3-oxoisoindol-1-ylidene)amino]propanamide |
| SMILES | CCCN1CCC(C#N)(NC(=O)C(CC2CCCCC2)/N=C2\NC(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C26H35N5O2/c1-2-14-31-15-12-26(18-27,13-16-31)30-25(33)22(17-19-8-4-3-5-9-19)28-23-20-10-6-7-11-21(20)24(32)29-23/h6-7,10-11,19,22H,2-5,8-9,12-17H2,1H3,(H,30,33)(H,28,29,32) |
| InChIKey | JMXPDBXHNWYUAX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|