C23H33N5O2 — CID 18270422
2-[[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-methylamino]-N-(1-cyanocyclohexyl)acetamide (PubChem CID 18270422) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 2-[[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-methylamino]-N-(1-cyanocyclohexyl)acetamide.
| Compound Name | 2-[[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-methylamino]-N-(1-cyanocyclohexyl)acetamide |
|---|---|
| PubChem CID | 18270422 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 2-[[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-methylamino]-N-(1-cyanocyclohexyl)acetamide |
| SMILES | CN(CC(=O)NC1(C#N)CCCCC1)CC(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H33N5O2/c1-26(17-21(29)25-23(19-24)10-6-3-7-11-23)18-22(30)28-14-12-27(13-15-28)16-20-8-4-2-5-9-20/h2,4-5,8-9H,3,6-7,10-18H2,1H3,(H,25,29) |
| InChIKey | UBIGJNTYANWPKU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |