C17H28N4O3 — CID 134018510
N-(1-cyanocycloheptyl)-2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide (PubChem CID 134018510) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide.
| Compound Name | N-(1-cyanocycloheptyl)-2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 134018510 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2-[methyl-(2-morpholin-4-yl-2-oxoethyl)amino]acetamide |
| SMILES | CN(CC(=O)NC1(C#N)CCCCCC1)CC(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H28N4O3/c1-20(13-16(23)21-8-10-24-11-9-21)12-15(22)19-17(14-18)6-4-2-3-5-7-17/h2-13H2,1H3,(H,19,22) |
| InChIKey | WHTVOPRZPXMPIQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |