C19H31N5O3 — CID 18208029
N-(1-cyanocyclohexyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]acetamide (PubChem CID 18208029) has the molecular formula C19H31N5O3 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 18208029 |
| Molecular Formula | C19H31N5O3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[4-(2-morpholin-4-yl-2-oxoethyl)piperazin-1-yl]acetamide |
| SMILES | N#CC1(NC(=O)CN2CCN(CC(=O)N3CCOCC3)CC2)CCCCC1 |
| InChI | InChI=1S/C19H31N5O3/c20-16-19(4-2-1-3-5-19)21-17(25)14-22-6-8-23(9-7-22)15-18(26)24-10-12-27-13-11-24/h1-15H2,(H,21,25) |
| InChIKey | NQQRPGHWVYNGFW-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |