C18H28N4O3 — CID 18229706
N-(1-cyanocyclohexyl)-2-[4-(oxolane-2-carbonyl)piperazin-1-yl]acetamide (PubChem CID 18229706) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-2-[4-(oxolane-2-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-(1-cyanocyclohexyl)-2-[4-(oxolane-2-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 18229706 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-(1-cyanocyclohexyl)-2-[4-(oxolane-2-carbonyl)piperazin-1-yl]acetamide |
| SMILES | N#CC1(NC(=O)CN2CCN(C(=O)C3CCCO3)CC2)CCCCC1 |
| InChI | InChI=1S/C18H28N4O3/c19-14-18(6-2-1-3-7-18)20-16(23)13-21-8-10-22(11-9-21)17(24)15-5-4-12-25-15/h15H,1-13H2,(H,20,23) |
| InChIKey | RCOYXYWPDCETLN-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |