C19H34N6O3S — CID 52675624
N-(1-cyanocycloheptyl)-2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetamide (PubChem CID 52675624) has the molecular formula C19H34N6O3S and a molecular weight of 426.59 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(1-cyanocycloheptyl)-2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 52675624 |
| Molecular Formula | C19H34N6O3S |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetamide |
| SMILES | CN1CCN(S(=O)(=O)N2CCN(CC(=O)NC3(C#N)CCCCCC3)CC2)CC1 |
| InChI | InChI=1S/C19H34N6O3S/c1-22-8-12-24(13-9-22)29(27,28)25-14-10-23(11-15-25)16-18(26)21-19(17-20)6-4-2-3-5-7-19/h2-16H2,1H3,(H,21,26) |
| InChIKey | NMTRMKHAHKUFHA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |