C21H27F3N4O3S — CID 30666896
N-(1-cyanocycloheptyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide (PubChem CID 30666896) has the molecular formula C21H27F3N4O3S and a molecular weight of 472.53 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide.
| Compound Name | N-(1-cyanocycloheptyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 30666896 |
| Molecular Formula | C21H27F3N4O3S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-(1-cyanocycloheptyl)-2-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]acetamide |
| SMILES | N#CC1(NC(=O)CN2CCN(S(=O)(=O)c3cccc(C(F)(F)F)c3)CC2)CCCCCC1 |
| InChI | InChI=1S/C21H27F3N4O3S/c22-21(23,24)17-6-5-7-18(14-17)32(30,31)28-12-10-27(11-13-28)15-19(29)26-20(16-25)8-3-1-2-4-9-20/h5-7,14H,1-4,8-13,15H2,(H,26,29) |
| InChIKey | JXHDDJVIHVTJGQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |