C23H28F2N2O2 — CID 166070730
tert-butyl N-[1-benzyl-4-(2,4-difluorophenyl)piperidin-4-yl]carbamate (PubChem CID 166070730) has the molecular formula C23H28F2N2O2 and a molecular weight of 402.49 g/mol. Its IUPAC name is tert-butyl N-[1-benzyl-4-(2,4-difluorophenyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-benzyl-4-(2,4-difluorophenyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 166070730 |
| Molecular Formula | C23H28F2N2O2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | tert-butyl N-[1-benzyl-4-(2,4-difluorophenyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(F)cc2F)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H28F2N2O2/c1-22(2,3)29-21(28)26-23(19-10-9-18(24)15-20(19)25)11-13-27(14-12-23)16-17-7-5-4-6-8-17/h4-10,15H,11-14,16H2,1-3H3,(H,26,28) |
| InChIKey | DVEQQTMPUIOLRB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |