C23H29FN2O2 — CID 166652951
[1-benzyl-4-(2-fluorophenyl)piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 166652951) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is [1-benzyl-4-(2-fluorophenyl)piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-benzyl-4-(2-fluorophenyl)piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 166652951 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [1-benzyl-4-(2-fluorophenyl)piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1(c2ccccc2F)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H29FN2O2/c1-22(2,3)25-21(27)28-23(19-11-7-8-12-20(19)24)13-15-26(16-14-23)17-18-9-5-4-6-10-18/h4-12H,13-17H2,1-3H3,(H,25,27) |
| InChIKey | VEYUIODRICRRQT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |