C13H20ClNO4 — CID 165439001
7-O-tert-butyl 1-O-(chloromethyl) 7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate (PubChem CID 165439001) has the molecular formula C13H20ClNO4 and a molecular weight of 289.76 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-(chloromethyl) 7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 1-O-(chloromethyl) 7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 165439001 |
| Molecular Formula | C13H20ClNO4 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 7-O-tert-butyl 1-O-(chloromethyl) 7-azabicyclo[2.2.1]heptane-1,7-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1(C(=O)OCCl)CC2 |
| InChI | InChI=1S/C13H20ClNO4/c1-12(2,3)19-11(17)15-9-4-6-13(15,7-5-9)10(16)18-8-14/h9H,4-8H2,1-3H3 |
| InChIKey | ONWRARPLYDICJX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|