C18H23NO3 — CID 67286302
tert-butyl 1-benzoyl-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 67286302) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl 1-benzoyl-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | tert-butyl 1-benzoyl-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 67286302 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | tert-butyl 1-benzoyl-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C18H23NO3/c1-17(2,3)22-16(21)19-14-9-11-18(19,12-10-14)15(20)13-7-5-4-6-8-13/h4-8,14H,9-12H2,1-3H3 |
| InChIKey | MHVPWLDVOOPWCD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |