C18H24BrNO3 — CID 67285210
tert-butyl 1-[(3-bromophenyl)-hydroxymethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 67285210) has the molecular formula C18H24BrNO3 and a molecular weight of 382.30 g/mol. Its IUPAC name is tert-butyl 1-[(3-bromophenyl)-hydroxymethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | tert-butyl 1-[(3-bromophenyl)-hydroxymethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 67285210 |
| Molecular Formula | C18H24BrNO3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | tert-butyl 1-[(3-bromophenyl)-hydroxymethyl]-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1(C(O)c1cccc(Br)c1)CC2 |
| InChI | InChI=1S/C18H24BrNO3/c1-17(2,3)23-16(22)20-14-7-9-18(20,10-8-14)15(21)12-5-4-6-13(19)11-12/h4-6,11,14-15,21H,7-10H2,1-3H3 |
| InChIKey | INHOLGJKLOFPHJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |