C16H22BrNO2 — CID 178194445
tert-butyl (2S)-2-(3-bromophenyl)-2-[(2R)-pyrrolidin-2-yl]acetate (PubChem CID 178194445) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is tert-butyl (2S)-2-(3-bromophenyl)-2-[(2R)-pyrrolidin-2-yl]acetate.
| Compound Name | tert-butyl (2S)-2-(3-bromophenyl)-2-[(2R)-pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 178194445 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | tert-butyl (2S)-2-(3-bromophenyl)-2-[(2R)-pyrrolidin-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)[C@@H](c1cccc(Br)c1)[C@H]1CCCN1 |
| InChI | InChI=1S/C16H22BrNO2/c1-16(2,3)20-15(19)14(13-8-5-9-18-13)11-6-4-7-12(17)10-11/h4,6-7,10,13-14,18H,5,8-9H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | NJQZOMFLOVHBEF-KGLIPLIRSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |