C14H19Cl2NO2 — CID 45259428
methyl (2S)-2-(3-chlorophenyl)-2-piperidin-2-ylacetate;hydrochloride (PubChem CID 45259428) has the molecular formula C14H19Cl2NO2 and a molecular weight of 304.22 g/mol. Its IUPAC name is methyl (2S)-2-(3-chlorophenyl)-2-piperidin-2-ylacetate;hydrochloride.
| Compound Name | methyl (2S)-2-(3-chlorophenyl)-2-piperidin-2-ylacetate;hydrochloride |
|---|---|
| PubChem CID | 45259428 |
| Molecular Formula | C14H19Cl2NO2 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | methyl (2S)-2-(3-chlorophenyl)-2-piperidin-2-ylacetate;hydrochloride |
| SMILES | COC(=O)[C@@H](c1cccc(Cl)c1)C1CCCCN1.Cl |
| InChI | InChI=1S/C14H18ClNO2.ClH/c1-18-14(17)13(12-7-2-3-8-16-12)10-5-4-6-11(15)9-10;/h4-6,9,12-13,16H,2-3,7-8H2,1H3;1H/t12?,13-;/m0./s1 |
| InChIKey | FNWXELQBKRXOHZ-ZEDZUCNESA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |