C19H24ClNO2 — CID 171381395
ethyl (2R)-2-naphthalen-2-yl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride (PubChem CID 171381395) has the molecular formula C19H24ClNO2 and a molecular weight of 333.86 g/mol. Its IUPAC name is ethyl (2R)-2-naphthalen-2-yl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride.
| Compound Name | ethyl (2R)-2-naphthalen-2-yl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 171381395 |
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | ethyl (2R)-2-naphthalen-2-yl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride |
| SMILES | CCOC(=O)[C@H](c1ccc2ccccc2c1)[C@@H]1CCCCN1.Cl |
| InChI | InChI=1S/C19H23NO2.ClH/c1-2-22-19(21)18(17-9-5-6-12-20-17)16-11-10-14-7-3-4-8-15(14)13-16;/h3-4,7-8,10-11,13,17-18,20H,2,5-6,9,12H2,1H3;1H/t17-,18+;/m0./s1 |
| InChIKey | UOJLOHIHPJXBLW-CJRXIRLBSA-N |
| XLogP | 4.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |