C26H45NO2Sn — CID 10768332
methyl 2-piperidin-2-yl-2-(4-tributylstannylphenyl)acetate (PubChem CID 10768332) has the molecular formula C26H45NO2Sn and a molecular weight of 522.36 g/mol. Its IUPAC name is methyl 2-piperidin-2-yl-2-(4-tributylstannylphenyl)acetate.
| Compound Name | methyl 2-piperidin-2-yl-2-(4-tributylstannylphenyl)acetate |
|---|---|
| PubChem CID | 10768332 |
| Molecular Formula | C26H45NO2Sn |
| Molecular Weight | 522.36 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | methyl 2-piperidin-2-yl-2-(4-tributylstannylphenyl)acetate |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(C(C(=O)OC)C2CCCCN2)cc1 |
| InChI | InChI=1S/C14H18NO2.3C4H9.Sn/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12;3*1-3-4-2;/h3-4,7-8,12-13,15H,5-6,9-10H2,1H3;3*1,3-4H2,2H3; |
| InChIKey | YYIFGNJDHFEVGC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.36 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |