C14H20BrNO2 — CID 67605642
methyl 2-phenyl-2-piperidin-2-ylacetate;hydrobromide (PubChem CID 67605642) has the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. Its IUPAC name is methyl 2-phenyl-2-piperidin-2-ylacetate;hydrobromide.
| Compound Name | methyl 2-phenyl-2-piperidin-2-ylacetate;hydrobromide |
|---|---|
| PubChem CID | 67605642 |
| Molecular Formula | C14H20BrNO2 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | methyl 2-phenyl-2-piperidin-2-ylacetate;hydrobromide |
| SMILES | Br.COC(=O)C(c1ccccc1)C1CCCCN1 |
| InChI | InChI=1S/C14H19NO2.BrH/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12;/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3;1H |
| InChIKey | RXLQQWUSBJTNGE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |