C15H25BrO4 — CID 151367160
ditert-butyl 3-(bromomethyl)cyclobutane-1,1-dicarboxylate (PubChem CID 151367160) has the molecular formula C15H25BrO4 and a molecular weight of 349.27 g/mol. Its IUPAC name is ditert-butyl 3-(bromomethyl)cyclobutane-1,1-dicarboxylate.
| Compound Name | ditert-butyl 3-(bromomethyl)cyclobutane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 151367160 |
| Molecular Formula | C15H25BrO4 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | ditert-butyl 3-(bromomethyl)cyclobutane-1,1-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)OC(C)(C)C)CC(CBr)C1 |
| InChI | InChI=1S/C15H25BrO4/c1-13(2,3)19-11(17)15(7-10(8-15)9-16)12(18)20-14(4,5)6/h10H,7-9H2,1-6H3 |
| InChIKey | OPRDQCRXGSAFFP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|