C15H26O4 — CID 165470114
3,3,5-trimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid (PubChem CID 165470114) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 3,3,5-trimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 3,3,5-trimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 165470114 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3,3,5-trimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclohexane-1-carboxylic acid |
| SMILES | CC1CC(C)(C)CC(C(=O)O)(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H26O4/c1-10-7-14(5,6)9-15(8-10,11(16)17)12(18)19-13(2,3)4/h10H,7-9H2,1-6H3,(H,16,17) |
| InChIKey | FDVBEYWBQBWMFI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|