C23H46O4 — CID 159354799
1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;cyclohexane (PubChem CID 159354799) has the molecular formula C23H46O4 and a molecular weight of 386.62 g/mol. Its IUPAC name is 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;cyclohexane.
| Compound Name | 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;cyclohexane |
|---|---|
| PubChem CID | 159354799 |
| Molecular Formula | C23H46O4 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;cyclohexane |
| SMILES | C1CCCCC1.CC1CC(C)(C)CC(OOC(C)(C)C)(OOC(C)(C)C)C1 |
| InChI | InChI=1S/C17H34O4.C6H12/c1-13-10-16(8,9)12-17(11-13,20-18-14(2,3)4)21-19-15(5,6)7;1-2-4-6-5-3-1/h13H,10-12H2,1-9H3;1-6H2 |
| InChIKey | LHUCLXKBDFJCNJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|