C27H52O12 — CID 121300201
1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;4-hydroperoxy-4-(2-hydroperoxy-4-oxopentan-2-yl)peroxypentan-2-one (PubChem CID 121300201) has the molecular formula C27H52O12 and a molecular weight of 568.70 g/mol. Its IUPAC name is 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;4-hydroperoxy-4-(2-hydroperoxy-4-oxopentan-2-yl)peroxypentan-2-one.
| Compound Name | 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;4-hydroperoxy-4-(2-hydroperoxy-4-oxopentan-2-yl)peroxypentan-2-one |
|---|---|
| PubChem CID | 121300201 |
| Molecular Formula | C27H52O12 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;4-hydroperoxy-4-(2-hydroperoxy-4-oxopentan-2-yl)peroxypentan-2-one |
| SMILES | CC(=O)CC(C)(OO)OOC(C)(CC(C)=O)OO.CC1CC(C)(C)CC(OOC(C)(C)C)(OOC(C)(C)C)C1 |
| InChI | InChI=1S/C17H34O4.C10H18O8/c1-13-10-16(8,9)12-17(11-13,20-18-14(2,3)4)21-19-15(5,6)7;1-7(11)5-9(3,15-13)17-18-10(4,16-14)6-8(2)12/h13H,10-12H2,1-9H3;13-14H,5-6H2,1-4H3 |
| InChIKey | GIEPILLBPZHWPY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|