C25H50O4 — CID 160789281
1,1-bis(2,2-dimethylhexan-3-ylperoxy)-3,3,5-trimethylcyclohexane (PubChem CID 160789281) has the molecular formula C25H50O4 and a molecular weight of 414.67 g/mol. Its IUPAC name is 1,1-bis(2,2-dimethylhexan-3-ylperoxy)-3,3,5-trimethylcyclohexane.
| Compound Name | 1,1-bis(2,2-dimethylhexan-3-ylperoxy)-3,3,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 160789281 |
| Molecular Formula | C25H50O4 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.37 |
| IUPAC Name | 1,1-bis(2,2-dimethylhexan-3-ylperoxy)-3,3,5-trimethylcyclohexane |
| SMILES | CCCC(OOC1(OOC(CCC)C(C)(C)C)CC(C)CC(C)(C)C1)C(C)(C)C |
| InChI | InChI=1S/C25H50O4/c1-12-14-20(22(4,5)6)26-28-25(17-19(3)16-24(10,11)18-25)29-27-21(15-13-2)23(7,8)9/h19-21H,12-18H2,1-11H3 |
| InChIKey | SBPYAULNBAZFDV-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|