C29H56O9 — CID 174876592
1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;1-(1-hydroperoxycyclohexyl)peroxycyclohexan-1-ol (PubChem CID 174876592) has the molecular formula C29H56O9 and a molecular weight of 548.76 g/mol. Its IUPAC name is 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;1-(1-hydroperoxycyclohexyl)peroxycyclohexan-1-ol.
| Compound Name | 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;1-(1-hydroperoxycyclohexyl)peroxycyclohexan-1-ol |
|---|---|
| PubChem CID | 174876592 |
| Molecular Formula | C29H56O9 |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | 1,1-bis(tert-butylperoxy)-3,3,5-trimethylcyclohexane;1-(1-hydroperoxycyclohexyl)peroxycyclohexan-1-ol |
| SMILES | CC1CC(C)(C)CC(OOC(C)(C)C)(OOC(C)(C)C)C1.OOC1(OOC2(O)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C17H34O4.C12H22O5/c1-13-10-16(8,9)12-17(11-13,20-18-14(2,3)4)21-19-15(5,6)7;13-11(7-3-1-4-8-11)16-17-12(15-14)9-5-2-6-10-12/h13H,10-12H2,1-9H3;13-14H,1-10H2 |
| InChIKey | NSZRNUKJYJRZKV-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|