C19H36O5 — CID 139970501
1-[1-(2,3,3-trimethylbutan-2-ylperoxy)cyclohexyl]peroxycyclohexan-1-ol (PubChem CID 139970501) has the molecular formula C19H36O5 and a molecular weight of 344.49 g/mol. Its IUPAC name is 1-[1-(2,3,3-trimethylbutan-2-ylperoxy)cyclohexyl]peroxycyclohexan-1-ol.
| Compound Name | 1-[1-(2,3,3-trimethylbutan-2-ylperoxy)cyclohexyl]peroxycyclohexan-1-ol |
|---|---|
| PubChem CID | 139970501 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | 1-[1-(2,3,3-trimethylbutan-2-ylperoxy)cyclohexyl]peroxycyclohexan-1-ol |
| SMILES | CC(C)(C)C(C)(C)OOC1(OOC2(O)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C19H36O5/c1-16(2,3)17(4,5)21-23-19(14-10-7-11-15-19)24-22-18(20)12-8-6-9-13-18/h20H,6-15H2,1-5H3 |
| InChIKey | OZEAHZQWJOZJTB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|