C14H26O5 — CID 152662622
3,3,5-trimethyl-1-[(2-methylpropan-2-yl)oxyperoxy]cyclohexane-1-carboxylic acid (PubChem CID 152662622) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is 3,3,5-trimethyl-1-[(2-methylpropan-2-yl)oxyperoxy]cyclohexane-1-carboxylic acid.
| Compound Name | 3,3,5-trimethyl-1-[(2-methylpropan-2-yl)oxyperoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 152662622 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 3,3,5-trimethyl-1-[(2-methylpropan-2-yl)oxyperoxy]cyclohexane-1-carboxylic acid |
| SMILES | CC1CC(C)(C)CC(OOOC(C)(C)C)(C(=O)O)C1 |
| InChI | InChI=1S/C14H26O5/c1-10-7-13(5,6)9-14(8-10,11(15)16)18-19-17-12(2,3)4/h10H,7-9H2,1-6H3,(H,15,16) |
| InChIKey | ZJVWSFURSCWMGU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|