C17H34O8 — CID 54047807
2,2-bis(tert-butylperoxy)-4,6,6-trimethyl-1-(trioxidanyl)cyclohexan-1-ol (PubChem CID 54047807) has the molecular formula C17H34O8 and a molecular weight of 366.45 g/mol. Its IUPAC name is 2,2-bis(tert-butylperoxy)-4,6,6-trimethyl-1-(trioxidanyl)cyclohexan-1-ol.
| Compound Name | 2,2-bis(tert-butylperoxy)-4,6,6-trimethyl-1-(trioxidanyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 54047807 |
| Molecular Formula | C17H34O8 |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2,2-bis(tert-butylperoxy)-4,6,6-trimethyl-1-(trioxidanyl)cyclohexan-1-ol |
| SMILES | CC1CC(C)(C)C(O)(OOO)C(OOC(C)(C)C)(OOC(C)(C)C)C1 |
| InChI | InChI=1S/C17H34O8/c1-12-10-15(8,9)17(18,24-25-19)16(11-12,22-20-13(2,3)4)23-21-14(5,6)7/h12,18-19H,10-11H2,1-9H3 |
| InChIKey | LQTYOALILYQFTB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|