C12H23NO3 — CID 165457232
2-[3,3,5-trimethyl-1-(methylaminooxy)cyclohexyl]acetic acid (PubChem CID 165457232) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is 2-[3,3,5-trimethyl-1-(methylaminooxy)cyclohexyl]acetic acid.
| Compound Name | 2-[3,3,5-trimethyl-1-(methylaminooxy)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 165457232 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 2-[3,3,5-trimethyl-1-(methylaminooxy)cyclohexyl]acetic acid |
| SMILES | CNOC1(CC(=O)O)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C12H23NO3/c1-9-5-11(2,3)8-12(6-9,16-13-4)7-10(14)15/h9,13H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | BRNZZBXSMVNRMZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|