C15H27NO5 — CID 165457650
2-[3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]oxycyclohexyl]acetic acid (PubChem CID 165457650) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is 2-[3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]oxycyclohexyl]acetic acid.
| Compound Name | 2-[3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]oxycyclohexyl]acetic acid |
|---|---|
| PubChem CID | 165457650 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 2-[3,3-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]oxycyclohexyl]acetic acid |
| SMILES | CC1(C)CCCC(CC(=O)O)(ONC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H27NO5/c1-13(2,3)20-12(19)16-21-15(9-11(17)18)8-6-7-14(4,5)10-15/h6-10H2,1-5H3,(H,16,19)(H,17,18) |
| InChIKey | KOGJXFDBABHJCJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|