C11H20O3 — CID 125453432
1-(3-methoxypropyl)-3,3-dimethylcyclobutane-1-carboxylic acid (PubChem CID 125453432) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-3,3-dimethylcyclobutane-1-carboxylic acid.
| Compound Name | 1-(3-methoxypropyl)-3,3-dimethylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 125453432 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 1-(3-methoxypropyl)-3,3-dimethylcyclobutane-1-carboxylic acid |
| SMILES | COCCCC1(C(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C11H20O3/c1-10(2)7-11(8-10,9(12)13)5-4-6-14-3/h4-8H2,1-3H3,(H,12,13) |
| InChIKey | REXQJGVGLZTFDL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|