C13H25O5PS — CID 144998262
tert-butyl 1,1-dioxo-4-[2-(phosphanylmethoxy)ethyl]thiane-4-carboxylate (PubChem CID 144998262) has the molecular formula C13H25O5PS and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl 1,1-dioxo-4-[2-(phosphanylmethoxy)ethyl]thiane-4-carboxylate.
| Compound Name | tert-butyl 1,1-dioxo-4-[2-(phosphanylmethoxy)ethyl]thiane-4-carboxylate |
|---|---|
| PubChem CID | 144998262 |
| Molecular Formula | C13H25O5PS |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | tert-butyl 1,1-dioxo-4-[2-(phosphanylmethoxy)ethyl]thiane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(CCOCP)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H25O5PS/c1-12(2,3)18-11(14)13(4-7-17-10-19)5-8-20(15,16)9-6-13/h4-10,19H2,1-3H3 |
| InChIKey | PJXCOPDRJDCMQM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|