C10H20N2O3 — CID 97041552
tert-butyl (3R)-1-amino-3-(hydroxymethyl)pyrrolidine-3-carboxylate (PubChem CID 97041552) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl (3R)-1-amino-3-(hydroxymethyl)pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl (3R)-1-amino-3-(hydroxymethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 97041552 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | tert-butyl (3R)-1-amino-3-(hydroxymethyl)pyrrolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@]1(CO)CCN(N)C1 |
| InChI | InChI=1S/C10H20N2O3/c1-9(2,3)15-8(14)10(7-13)4-5-12(11)6-10/h13H,4-7,11H2,1-3H3/t10-/m1/s1 |
| InChIKey | AVNZQLNFDYKTDW-SNVBAGLBSA-N |
| XLogP | -0.11 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|