C14H18O3 — CID 164928886
tert-butyl 4-(hydroxymethyl)cubane-1-carboxylate (PubChem CID 164928886) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is tert-butyl 4-(hydroxymethyl)cubane-1-carboxylate.
| Compound Name | tert-butyl 4-(hydroxymethyl)cubane-1-carboxylate |
|---|---|
| PubChem CID | 164928886 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | tert-butyl 4-(hydroxymethyl)cubane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12C3C4C1C1C2C3C41CO |
| InChI | InChI=1S/C14H18O3/c1-12(2,3)17-11(16)14-8-5-9(14)7-10(14)6(8)13(5,7)4-15/h5-10,15H,4H2,1-3H3 |
| InChIKey | ABPYTALOIXGFQM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |