C24H45NO6 — CID 58679937
tert-butyl N-[(Z,2S,3R)-1,3-dihydroxy-14-(oxan-2-yloxy)tetradec-4-en-2-yl]carbamate (PubChem CID 58679937) has the molecular formula C24H45NO6 and a molecular weight of 443.63 g/mol. Its IUPAC name is tert-butyl N-[(Z,2S,3R)-1,3-dihydroxy-14-(oxan-2-yloxy)tetradec-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z,2S,3R)-1,3-dihydroxy-14-(oxan-2-yloxy)tetradec-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58679937 |
| Molecular Formula | C24H45NO6 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.32 |
| IUPAC Name | tert-butyl N-[(Z,2S,3R)-1,3-dihydroxy-14-(oxan-2-yloxy)tetradec-4-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)[C@H](O)/C=C\CCCCCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C24H45NO6/c1-24(2,3)31-23(28)25-20(19-26)21(27)15-11-9-7-5-4-6-8-10-13-17-29-22-16-12-14-18-30-22/h11,15,20-22,26-27H,4-10,12-14,16-19H2,1-3H3,(H,25,28)/b15-11-/t20-,21+,22?/m0/s1 |
| InChIKey | HYADFCWXJVJALD-PWMKARHOSA-N |
| XLogP | 4.45 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|