C37H64N2O6 — CID 78045854
11-(oxan-2-yloxy)-N-[3-[11-(oxan-2-yloxy)undec-2-enoylamino]cyclopentyl]undec-2-enamide (PubChem CID 78045854) has the molecular formula C37H64N2O6 and a molecular weight of 632.93 g/mol. Its IUPAC name is 11-(oxan-2-yloxy)-N-[3-[11-(oxan-2-yloxy)undec-2-enoylamino]cyclopentyl]undec-2-enamide.
| Compound Name | 11-(oxan-2-yloxy)-N-[3-[11-(oxan-2-yloxy)undec-2-enoylamino]cyclopentyl]undec-2-enamide |
|---|---|
| PubChem CID | 78045854 |
| Molecular Formula | C37H64N2O6 |
| Molecular Weight | 632.93 g/mol |
| Exact Mass | 632.48 |
| IUPAC Name | 11-(oxan-2-yloxy)-N-[3-[11-(oxan-2-yloxy)undec-2-enoylamino]cyclopentyl]undec-2-enamide |
| SMILES | O=C(C=CCCCCCCCCOC1CCCCO1)NC1CCC(NC(=O)C=CCCCCCCCCOC2CCCCO2)C1 |
| InChI | InChI=1S/C37H64N2O6/c40-34(21-13-9-5-1-3-7-11-17-27-42-36-23-15-19-29-44-36)38-32-25-26-33(31-32)39-35(41)22-14-10-6-2-4-8-12-18-28-43-37-24-16-20-30-45-37/h13-14,21-22,32-33,36-37H,1-12,15-20,23-31H2,(H,38,40)(H,39,41) |
| InChIKey | NMEZGWFQVJLHRC-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.93 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|