C25H44N2O2 — CID 144516859
(E)-N-[(1S,3R)-3-[[(E)-dec-2-enoyl]amino]cyclopentyl]dec-2-enamide (PubChem CID 144516859) has the molecular formula C25H44N2O2 and a molecular weight of 404.64 g/mol. Its IUPAC name is (E)-N-[(1S,3R)-3-[[(E)-dec-2-enoyl]amino]cyclopentyl]dec-2-enamide.
| Compound Name | (E)-N-[(1S,3R)-3-[[(E)-dec-2-enoyl]amino]cyclopentyl]dec-2-enamide |
|---|---|
| PubChem CID | 144516859 |
| Molecular Formula | C25H44N2O2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | (E)-N-[(1S,3R)-3-[[(E)-dec-2-enoyl]amino]cyclopentyl]dec-2-enamide |
| SMILES | CCCCCCC/C=C/C(=O)N[C@@H]1CC[C@H](NC(=O)/C=C/CCCCCCC)C1 |
| InChI | InChI=1S/C25H44N2O2/c1-3-5-7-9-11-13-15-17-24(28)26-22-19-20-23(21-22)27-25(29)18-16-14-12-10-8-6-4-2/h15-18,22-23H,3-14,19-21H2,1-2H3,(H,26,28)(H,27,29)/b17-15+,18-16+/t22-,23+ |
| InChIKey | SRIAKSBCLRIAEL-RHCUQMLUSA-N |
| XLogP | 5.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|