C22H40N2O2 — CID 144516731
(E)-N-[(1R,3S)-3-methylcyclopentyl]oct-2-enamide;(E)-oct-2-enamide (PubChem CID 144516731) has the molecular formula C22H40N2O2 and a molecular weight of 364.57 g/mol. Its IUPAC name is (E)-N-[(1R,3S)-3-methylcyclopentyl]oct-2-enamide;(E)-oct-2-enamide.
| Compound Name | (E)-N-[(1R,3S)-3-methylcyclopentyl]oct-2-enamide;(E)-oct-2-enamide |
|---|---|
| PubChem CID | 144516731 |
| Molecular Formula | C22H40N2O2 |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | (E)-N-[(1R,3S)-3-methylcyclopentyl]oct-2-enamide;(E)-oct-2-enamide |
| SMILES | CCCCC/C=C/C(=O)N[C@@H]1CC[C@H](C)C1.CCCCC/C=C/C(N)=O |
| InChI | InChI=1S/C14H25NO.C8H15NO/c1-3-4-5-6-7-8-14(16)15-13-10-9-12(2)11-13;1-2-3-4-5-6-7-8(9)10/h7-8,12-13H,3-6,9-11H2,1-2H3,(H,15,16);6-7H,2-5H2,1H3,(H2,9,10)/b8-7+;7-6+/t12-,13+;/m0./s1 |
| InChIKey | WQCDRPLOMAQDNX-BPYQUUKPSA-N |
| XLogP | 5.04 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|